CAS 138402-36-5

3-Pyridinemethanamine,5-chloro-(9CI)

Description:

3-Pyridinemethanamine, 5-chloro- (9CI), with the CAS number 138402-36-5, is an organic compound characterized by a pyridine ring substituted with a chloromethyl group and an amino group. This compound features a five-membered aromatic heterocyclic structure, which contributes to its chemical reactivity and potential biological activity. The presence of the amino group (-NH2) makes it a basic compound, capable of forming salts with acids, while the chlorine atom introduces a halogen functionality that can participate in various chemical reactions, such as nucleophilic substitutions. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the pyridine moiety's role in enhancing bioactivity. Additionally, its solubility and stability in various solvents can vary, influencing its use in different chemical environments. Overall, 3-Pyridinemethanamine, 5-chloro- is a compound of interest in both synthetic and medicinal chemistry contexts.

Formula: C₆H₇ClN₂

InChI: InChI=1/C6H7ClN2/c7-6-1-5(2-8)3-9-4-6/h1,3-4H,2,8H2

SMILES: c1c(CN)cncc1Cl

(5-Chloropyridin-3-yl)methanamine

CAS: 138402-36-5

Formula: C₆H₇ClN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 142.5862

Ref: IN-DA0018Q4

3-(Aminomethyl)-5-chloropyridine

CAS: 138402-36-5

3-(Aminomethyl)-5-chloropyridine

Purity: 98%

Molecular weight: 142.59g/mol

Ref: 54-OR85170

3-(AMINOMETHYL)-5-CHLOROPYRIDINE

CAS: 138402-36-5

Formula: C₆H₇ClN₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 142.59

Ref: 10-F386856