CAS 138426-29-6

5-Chloro-3-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazole

Description:

5-Chloro-3-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazole is a heterocyclic compound characterized by the presence of a thiadiazole ring, which consists of two nitrogen atoms and one sulfur atom in a five-membered ring. The compound features a chloro substituent at the 5-position and a trifluoromethylphenyl group at the 3-position, contributing to its unique chemical properties. The trifluoromethyl group is known for enhancing lipophilicity and biological activity, making this compound of interest in pharmaceutical and agrochemical research. Its structure suggests potential applications in various fields, including medicinal chemistry, due to the presence of the thiadiazole moiety, which is often associated with antimicrobial and anti-inflammatory activities. The compound's stability, solubility, and reactivity can be influenced by the electron-withdrawing trifluoromethyl group and the chlorinated aromatic system, making it a versatile candidate for further chemical modifications and studies. Overall, 5-Chloro-3-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazole exhibits distinct characteristics that warrant exploration in synthetic and applied chemistry contexts.

Formula: C₉H₄ClF₃N₂S

InChI: InChI=1S/C9H4ClF3N2S/c10-8-14-7(15-16-8)5-2-1-3-6(4-5)9(11,12)13/h1-4H

InChI key: InChIKey=RNFCBGATYRHEBF-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(C=CC1)C=2N=C(Cl)SN2

Synonyms:

• 5-Chloro-3-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazole
• 1,2,4-Thiadiazole, 5-chloro-3-[3-(trifluoromethyl)phenyl]-
• 5-Chloro-3-[3-trifluoromethylphenyl]-1,2,4-thiadiazole

5-chloro-3-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazole

CAS: 138426-29-6

Formula: C₉H₄ClF₃N₂S

Purity: 95.0%

Molecular weight: 264.65

Ref: 10-F522554