CymitQuimica logo

CAS 1384264-43-0

:

5-Chloro-3-fluoro-α-methyl-2-pyridinemethanamine

Description:
5-Chloro-3-fluoro-α-methyl-2-pyridinemethanamine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen. The presence of chlorine and fluorine substituents at the 5 and 3 positions, respectively, contributes to its unique reactivity and potential applications in medicinal chemistry. The α-methyl group enhances its lipophilicity, which can influence its pharmacokinetic properties. This compound may exhibit biological activity due to its structural features, making it of interest in drug discovery and development. Its amine functional group can participate in hydrogen bonding, affecting solubility and interaction with biological targets. The specific arrangement of substituents can also impact the compound's stereochemistry, influencing its overall behavior in chemical reactions and biological systems. As with many pyridine derivatives, it may be involved in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it a versatile building block in organic synthesis. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C7H8ClFN2
InChI:InChI=1S/C7H8ClFN2/c1-4(10)7-6(9)2-5(8)3-11-7/h2-4H,10H2,1H3
InChI key:InChIKey=MAYQGJSDQBLXHN-UHFFFAOYSA-N
SMILES:C(C)(N)C1=C(F)C=C(Cl)C=N1
Synonyms:
  • 2-Pyridinemethanamine, 5-chloro-3-fluoro-α-methyl-
  • 5-Chloro-3-fluoro-α-methyl-2-pyridinemethanamine
  • 1-(5-Chloro-3-fluoropyridin-2-yl)ethanamine
Found 0 products.