CymitQuimica logo

CAS 1384427-36-4

:

Bicyclo[2.2.1]heptane-1-carboxylic acid, 4-amino-, hydrochloride (1:1)

Description:
Bicyclo[2.2.1]heptane-1-carboxylic acid, 4-amino-, hydrochloride (1:1) is a bicyclic organic compound characterized by its unique bicyclic structure, which consists of a seven-membered ring system. The presence of a carboxylic acid functional group contributes to its acidic properties, while the amino group introduces basic characteristics, making it a zwitterionic compound in certain conditions. The hydrochloride form indicates that the compound is protonated, enhancing its solubility in polar solvents, particularly water. This compound is of interest in medicinal chemistry due to its potential biological activity, which may include interactions with various biological targets. Its structural features may influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion. Additionally, the bicyclic framework can provide rigidity, which is often beneficial in drug design. As with many chemical substances, safety data should be consulted to understand its handling and potential hazards. Overall, this compound exemplifies the complexity and diversity of organic molecules in pharmaceutical applications.
Formula:C8H13NO2·ClH
InChI:InChI=1S/C8H13NO2.ClH/c9-8-3-1-7(5-8,2-4-8)6(10)11;/h1-5,9H2,(H,10,11);1H
InChI key:InChIKey=LQJXNKWRMYPICI-UHFFFAOYSA-N
SMILES:C(O)(=O)C12CC(N)(CC1)CC2.Cl
Synonyms:
  • Bicyclo[2.2.1]heptane-1-carboxylic acid, 4-amino-, hydrochloride (1:1)
  • 4-Aminobicyclo[2.2.1]heptane-1-carboxylic acid hydrochloride
Found 4 products.