CAS 1384427-67-1

1H-Pyrazole-4-ethanamine, 3,5-dimethyl-1-phenyl-β-(trifluoromethyl)-, hydrochloride (1:1)

Description:

1H-Pyrazole-4-ethanamine, 3,5-dimethyl-1-phenyl-β-(trifluoromethyl)-, hydrochloride (1:1), with CAS number 1384427-67-1, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a trifluoromethyl group, which enhances its lipophilicity and may influence its biological activity. The presence of the 3,5-dimethyl and phenyl substituents contributes to its structural complexity and potential interactions with biological targets. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and stability, would depend on the conditions under which it is synthesized and stored. Overall, this compound represents a unique structure that may have implications in drug development and research.

Formula: C₁₄H₁₆F₃N₃·ClH

InChI: InChI=1S/C14H16F3N3.ClH/c1-9-13(12(8-18)14(15,16)17)10(2)20(19-9)11-6-4-3-5-7-11;/h3-7,12H,8,18H2,1-2H3;1H

InChI key: InChIKey=YHNOQHOQSJQFLV-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(CN)C1=C(C)N(N=C1C)C2=CC=CC=C2.Cl

Synonyms:

• 1H-Pyrazole-4-ethanamine, 3,5-dimethyl-1-phenyl-β-(trifluoromethyl)-, hydrochloride (1:1)

2-(3,5-Dimethyl-1-phenyl-1H-pyrazol-4-yl)-3,3,3-trifluoropropan-1-amine hydrochloride

CAS: 1384427-67-1

Versatile small molecule scaffold

Formula: C₁₄H₁₇ClF₃N₃

Purity: Min. 95%

Molecular weight: 319.75 g/mol

Ref: 3D-JFC42767