CAS 1384427-71-7

Pyrido[4,3-c]pyridazin-3(2H)-one, 5,6,7,8-tetrahydro-2-[2-oxo-2-(1-pyrrolidinyl)ethyl]-, hydrochloride (1:1)

Description:

Pyrido[4,3-c]pyridazin-3(2H)-one, 5,6,7,8-tetrahydro-2-[2-oxo-2-(1-pyrrolidinyl)ethyl]-, hydrochloride (1:1) is a complex organic compound characterized by its unique bicyclic structure, which incorporates both pyridine and pyridazine rings. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and includes a pyrrolidine moiety, contributing to its potential biological activity. The hydrochloride salt form suggests enhanced solubility in aqueous environments, which is often advantageous for pharmacological applications. The presence of the keto group (2-oxo) and the specific substitution patterns on the rings may influence its reactivity and interaction with biological targets. Such compounds are often investigated for their potential therapeutic effects, particularly in the fields of medicinal chemistry and drug development. The molecular weight, melting point, and specific solubility characteristics would typically be determined through experimental methods, providing further insight into its physical properties and potential applications.

Formula: C₁₃H₁₈N₄O₂·ClH

InChI: InChI=1S/C13H18N4O2.ClH/c18-12-7-10-8-14-4-3-11(10)15-17(12)9-13(19)16-5-1-2-6-16;/h7,14H,1-6,8-9H2;1H

InChI key: InChIKey=LTECSHMKHCJORI-UHFFFAOYSA-N

SMILES: C(C(=O)N1CCCC1)N2N=C3C(=CC2=O)CNCC3.Cl

Synonyms:

• Pyrido[4,3-c]pyridazin-3(2H)-one, 5,6,7,8-tetrahydro-2-[2-oxo-2-(1-pyrrolidinyl)ethyl]-, hydrochloride (1:1)

2-[2-Oxo-2-(pyrrolidin-1-yl)ethyl]-2H,3H,5H,6H,7H,8H-pyrido[4,3-c]pyridazin-3-one hydrochloride

CAS: 1384427-71-7

Versatile small molecule scaffold

Formula: C₁₃H₁₉ClN₄O₂

Purity: Min. 95%

Molecular weight: 298.77 g/mol

Ref: 3D-JFC42771