CAS 1384427-75-1

Isoquinoline, 3-cyclohexyl-1,2,3,4-tetrahydro-7-methoxy-, hydrochloride (1:1)

Description:

Isoquinoline, 3-cyclohexyl-1,2,3,4-tetrahydro-7-methoxy-, hydrochloride (1:1) is a chemical compound characterized by its isoquinoline structure, which is a bicyclic aromatic compound. This specific derivative features a cyclohexyl group and a methoxy group, contributing to its unique properties. The presence of the tetrahydro configuration indicates that the compound has undergone partial hydrogenation, resulting in a saturated ring system that can influence its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. The compound may exhibit various pharmacological activities, potentially making it of interest in medicinal chemistry. Its molecular interactions, stability, and solubility are influenced by the functional groups present, which can affect its behavior in biological systems. Overall, this compound represents a specific class of isoquinoline derivatives with potential applications in drug development and research.

Formula: C₁₆H₂₃NO·ClH

InChI: InChI=1S/C16H23NO.ClH/c1-18-15-8-7-13-10-16(17-11-14(13)9-15)12-5-3-2-4-6-12;/h7-9,12,16-17H,2-6,10-11H2,1H3;1H

InChI key: InChIKey=KKQARNJNLWDFPH-UHFFFAOYSA-N

SMILES: O(C)C=1C=C2C(CC(NC2)C3CCCCC3)=CC1.Cl

Synonyms:

• Isoquinoline, 3-cyclohexyl-1,2,3,4-tetrahydro-7-methoxy-, hydrochloride (1:1)

3-Cyclohexyl-7-methoxy-1,2,3,4-tetrahydroisoquinoline hydrochloride

CAS: 1384427-75-1

Versatile small molecule scaffold

Formula: C₁₆H₂₄ClNO

Purity: Min. 95%

Molecular weight: 281.82 g/mol

Ref: 3D-JFC42775