CAS 1384427-97-7

Cyclobutanemethanamine, N-(2,2-difluoroethyl)-, hydrochloride (1:1)

Description:

Cyclobutanemethanamine, N-(2,2-difluoroethyl)-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cyclobutane ring and a difluoroethyl substituent attached to an amine group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its handling in various applications. The presence of the difluoroethyl group suggests potential biological activity, as fluorinated compounds often exhibit altered pharmacokinetics and increased metabolic stability. The hydrochloride form indicates that the amine is protonated, which can influence its reactivity and interaction with biological systems. Cyclobutanemethanamine derivatives may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to their structural features that can modulate biological activity. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would be influenced by its molecular structure and the presence of the hydrochloride group. Overall, this compound represents a class of amines with potential applications in various fields, including drug development and materials science.

Formula: C₇H₁₃F₂N·ClH

InChI: InChI=1S/C7H13F2N.ClH/c8-7(9)5-10-4-6-2-1-3-6;/h6-7,10H,1-5H2;1H

InChI key: InChIKey=DVBRXEOMHKKVMT-UHFFFAOYSA-N

SMILES: C(NCC(F)F)C1CCC1.Cl

Synonyms:

• Cyclobutanemethanamine, N-(2,2-difluoroethyl)-, hydrochloride (1:1)

(Cyclobutylmethyl)(2,2-difluoroethyl)amine hydrochloride

CAS: 1384427-97-7

Versatile small molecule scaffold

Formula: C₇H₁₄ClF₂N

Purity: Min. 95%

Molecular weight: 185.64 g/mol

Ref: 3D-JFC42797