CAS 1384427-98-8

3-Pyrrolidinamine, 1-methyl-4-phenyl-, hydrochloride (1:2)

Description:

3-Pyrrolidinamine, 1-methyl-4-phenyl-, hydrochloride (1:2) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This substance features a methyl group and a phenyl group attached to the nitrogen atom of the pyrrolidine, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its solubility in water and facilitates its use in various applications, including pharmaceuticals and research. The compound may exhibit biological activity, potentially influencing neurotransmitter systems due to its structural similarity to other psychoactive substances. Its molecular interactions can be influenced by the presence of the hydrochloride moiety, which can affect its stability and reactivity. Safety and handling precautions are essential, as with many nitrogen-containing compounds, due to potential toxicity or reactivity. Overall, 3-Pyrrolidinamine, 1-methyl-4-phenyl-, hydrochloride (1:2) is of interest in medicinal chemistry and pharmacology, warranting further investigation into its properties and potential applications.

Formula: C₁₁H₁₆N₂·2ClH

InChI: InChI=1S/C11H16N2.2ClH/c1-13-7-10(11(12)8-13)9-5-3-2-4-6-9;;/h2-6,10-11H,7-8,12H2,1H3;2*1H

InChI key: InChIKey=FEQWVVMPUJNUQY-UHFFFAOYSA-N

SMILES: NC1C(CN(C)C1)C2=CC=CC=C2.Cl

Synonyms:

• 3-Pyrrolidinamine, 1-methyl-4-phenyl-, hydrochloride (1:2)

1-Methyl-4-phenylpyrrolidin-3-amine dihydrochloride

CAS: 1384427-98-8

Versatile small molecule scaffold

Formula: C₁₁H₁₈Cl₂N₂

Purity: Min. 95%

Molecular weight: 249.18 g/mol

Ref: 3D-JFC42798