CAS 1384428-02-7

2-[(Ethylsulfonyl)amino]ethanesulfonyl chloride

Description:

2-[(Ethylsulfonyl)amino]ethanesulfonyl chloride is a sulfonamide compound characterized by the presence of both sulfonyl and amino functional groups. This compound features an ethylsulfonyl group attached to an amino group, which is further connected to an ethanesulfonyl chloride moiety. The presence of the sulfonyl chloride functional group indicates that it is likely reactive, particularly with nucleophiles, making it useful in various synthetic applications. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to its sulfonyl and amino functionalities. Its reactivity can be attributed to the electrophilic nature of the sulfonyl chloride, which can participate in substitution reactions. Additionally, the compound may have applications in medicinal chemistry, particularly in the development of sulfonamide-based pharmaceuticals. Safety precautions should be taken when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or moisture.

Formula: C₄H₁₀ClNO₄S₂

InChI: InChI=1S/C4H10ClNO4S2/c1-2-12(9,10)6-3-4-11(5,7)8/h6H,2-4H2,1H3

InChI key: InChIKey=IGZDHFKWRYPSSU-UHFFFAOYSA-N

SMILES: S(NCCS(Cl)(=O)=O)(CC)(=O)=O

Synonyms:

• 2-[(Ethylsulfonyl)amino]ethanesulfonyl chloride
• Ethanesulfonyl chloride, 2-[(ethylsulfonyl)amino]-

2-Ethanesulfonamidoethane-1-sulfonyl chloride

CAS: 1384428-02-7

Versatile small molecule scaffold

Formula: C₄H₁₀ClNO₄S₂

Purity: Min. 95%

Molecular weight: 235.7 g/mol

Ref: 3D-JFC42802