CAS 1384428-34-5

Benzenemethanamine, 4-[(difluoromethyl)thio]-α-methyl-, hydrochloride (1:1)

Description:

Benzenemethanamine, 4-[(difluoromethyl)thio]-α-methyl-, hydrochloride (1:1), identified by its CAS number 1384428-34-5, is a chemical compound characterized by its amine functional group and the presence of a difluoromethylthio substituent. This compound features a benzene ring, which contributes to its aromatic properties, and an α-methyl group that influences its steric and electronic characteristics. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in polar solvents, particularly water. The difluoromethylthio group introduces unique reactivity and potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of fluorine atoms often enhances metabolic stability and lipophilicity, which can affect the compound's pharmacokinetics. Overall, this compound's structural features suggest potential applications in pharmaceuticals, particularly in the development of therapeutic agents targeting specific biological pathways. However, detailed studies on its biological activity, toxicity, and environmental impact would be necessary to fully understand its characteristics and applications.

Formula: C₉H₁₁F₂NS·ClH

InChI: InChI=1S/C9H11F2NS.ClH/c1-6(12)7-2-4-8(5-3-7)13-9(10)11;/h2-6,9H,12H2,1H3;1H

InChI key: InChIKey=DUEXLUMMSYLXCU-UHFFFAOYSA-N

SMILES: S(C(F)F)C1=CC=C(C(C)N)C=C1.Cl

Synonyms:

• Benzenemethanamine, 4-[(difluoromethyl)thio]-α-methyl-, hydrochloride (1:1)

1-{4-[(Difluoromethyl)sulfanyl]phenyl}ethan-1-amine hydrochloride

CAS: 1384428-34-5

Versatile small molecule scaffold

Formula: C₉H₁₂ClF₂NS

Purity: Min. 95%

Molecular weight: 239.71 g/mol

Ref: 3D-JFC42834