CAS 1384428-50-5

Benzeneethanamine, N-cyclopentyl-4-fluoro-, hydrochloride (1:1)

Description:

Benzeneethanamine, N-cyclopentyl-4-fluoro-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and a cyclopentyl substituent, along with a fluorine atom at the para position of the benzene ring. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it more stable for handling and storage. The presence of the fluorine atom can influence the compound's reactivity and biological activity, often enhancing lipophilicity and altering pharmacokinetic properties. As an amine, it can participate in various chemical reactions, including alkylation and acylation. The compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential interactions with biological targets. Safety data sheets should be consulted for handling precautions, as amines can be irritants and may pose health risks. Overall, this compound exemplifies the complexity and utility of substituted amines in chemical and pharmaceutical research.

Formula: C₁₃H₁₈FN·ClH

InChI: InChI=1S/C13H18FN.ClH/c14-12-7-5-11(6-8-12)9-10-15-13-3-1-2-4-13;/h5-8,13,15H,1-4,9-10H2;1H

InChI key: InChIKey=QAHRACIUTGOJFH-UHFFFAOYSA-N

SMILES: C(CNC1CCCC1)C2=CC=C(F)C=C2.Cl

Synonyms:

• Benzeneethanamine, N-cyclopentyl-4-fluoro-, hydrochloride (1:1)

N-[2-(4-Fluorophenyl)ethyl]cyclopentanamine hydrochloride

Controlled Product

CAS: 1384428-50-5

Versatile small molecule scaffold

Formula: C₁₃H₁₉ClFN

Purity: Min. 95%

Molecular weight: 243.75 g/mol

Ref: 3D-JFC42850