CAS 1384428-66-3

2-Pyrazinecarbonitrile, 3-(3-methyl-1-piperazinyl)-, hydrochloride (1:1)

Description:

2-Pyrazinecarbonitrile, 3-(3-methyl-1-piperazinyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrazine and piperazine moieties, which contribute to its biological activity and potential pharmacological applications. This compound typically appears as a white to off-white solid and is soluble in polar solvents, reflecting its ionic nature due to the hydrochloride salt formation. The presence of the cyano group (nitrile) and the piperazine ring suggests that it may exhibit diverse interactions with biological targets, potentially influencing its efficacy in medicinal chemistry. Its molecular structure allows for hydrogen bonding and other intermolecular interactions, which can affect its pharmacokinetics and bioavailability. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Further studies would be necessary to elucidate its specific biological activities and therapeutic potential.

Formula: C₁₀H₁₃N₅·ClH

InChI: InChI=1S/C10H13N5.ClH/c1-8-7-15(5-4-12-8)10-9(6-11)13-2-3-14-10;/h2-3,8,12H,4-5,7H2,1H3;1H

InChI key: InChIKey=GAOUFCAISWXUIM-UHFFFAOYSA-N

SMILES: C(#N)C=1C(=NC=CN1)N2CC(C)NCC2.Cl

Synonyms:

• 2-Pyrazinecarbonitrile, 3-(3-methyl-1-piperazinyl)-, hydrochloride (1:1)

3-(3-Methylpiperazin-1-yl)pyrazine-2-carbonitrile hydrochloride

CAS: 1384428-66-3

Versatile small molecule scaffold

Formula: C₁₀H₁₄ClN₅

Purity: Min. 95%

Molecular weight: 239.7 g/mol

Ref: 3D-JFC42866