CAS 1384428-89-0

Cyclohexanol, 3-(methylsulfonyl)-, 1-methanesulfonate

Description:

Cyclohexanol, 3-(methylsulfonyl)-, 1-methanesulfonate, with the CAS number 1384428-89-0, is an organic compound characterized by its cyclohexanol backbone modified with methylsulfonyl and methanesulfonate functional groups. This compound typically appears as a colorless to pale yellow liquid and is soluble in polar solvents due to the presence of sulfonate groups, which enhance its hydrophilicity. The methylsulfonyl group contributes to its potential as a polar aprotic solvent, while the methanesulfonate moiety can act as a leaving group in various chemical reactions. Cyclohexanol derivatives are often studied for their applications in organic synthesis, pharmaceuticals, and as intermediates in chemical manufacturing. The presence of sulfonate groups may also impart unique reactivity patterns, making this compound of interest in the development of new synthetic methodologies. Safety data should be consulted for handling and storage, as sulfonate compounds can exhibit varying degrees of toxicity and environmental impact.

Formula: C₈H₁₆O₅S₂

InChI: InChI=1S/C8H16O5S2/c1-14(9,10)8-5-3-4-7(6-8)13-15(2,11)12/h7-8H,3-6H2,1-2H3

InChI key: InChIKey=WTAQJAJJNNJOPU-UHFFFAOYSA-N

SMILES: O(S(C)(=O)=O)C1CC(S(C)(=O)=O)CCC1

Synonyms:

• Cyclohexanol, 3-(methylsulfonyl)-, 1-methanesulfonate

3-Methanesulfonylcyclohexyl methanesulfonate

CAS: 1384428-89-0

Versatile small molecule scaffold

Formula: C₈H₁₆O₅S₂

Purity: Min. 95%

Molecular weight: 256.3 g/mol

Ref: 3D-JFC42889