CAS 1384428-91-4

Cyclobutaneacetamide, 1-amino-, hydrochloride (1:1)

Description:

Cyclobutaneacetamide, 1-amino-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from cyclobutane and acetic acid. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to its free base. The molecular structure includes a cyclobutane ring, contributing to its unique cyclic properties, and an amino group that can participate in hydrogen bonding, influencing its reactivity and interaction with biological systems. As a hydrochloride salt, it is often more stable and easier to handle than its non-salt counterpart. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. However, specific details regarding its toxicity, pharmacokinetics, and therapeutic uses would require further investigation and are typically found in specialized literature or databases.

Formula: C₆H₁₂N₂O·ClH

InChI: InChI=1S/C6H12N2O.ClH/c7-5(9)4-6(8)2-1-3-6;/h1-4,8H2,(H2,7,9);1H

InChI key: InChIKey=ATWJAYXTMYRRIC-UHFFFAOYSA-N

SMILES: C(C(N)=O)C1(N)CCC1.Cl

Synonyms:

• Cyclobutaneacetamide, 1-amino-, hydrochloride (1:1)

2-(1-Aminocyclobutyl)acetamide hydrochloride

CAS: 1384428-91-4

Formula: C₆H₁₃ClN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 164.6332

Ref: IN-DA019YWM

2-(1-Aminocyclobutyl)acetamide hydrochloride

CAS: 1384428-91-4

Purity: 95%

Molecular weight: 164.6300049

Ref: 10-F649020

2-(1-Aminocyclobutyl)acetamide hydrochloride

CAS: 1384428-91-4

Versatile small molecule scaffold

Formula: C₆H₁₃ClN₂O

Purity: Min. 95%

Molecular weight: 164.63 g/mol

Ref: 3D-JFC42891