CAS 1384429-04-2

1H-Tetrazole-5-methanamine, N,1-dimethyl-, hydrochloride (1:1)

Description:

1H-Tetrazole-5-methanamine, N,1-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its tetrazole ring structure, which is a five-membered aromatic ring containing four nitrogen atoms and one carbon atom. This compound features a dimethylamino group, contributing to its basicity and potential reactivity. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in polar solvents like water. The presence of the tetrazole moiety imparts unique properties, making it of interest in medicinal chemistry, particularly for its potential as a bioisostere for carboxylic acids. The compound may exhibit various biological activities, including antimicrobial and anticonvulsant properties, due to its ability to interact with biological targets. Its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Safety data should be consulted for handling, as with any chemical, to ensure proper precautions are taken during use and storage.

Formula: C₄H₉N₅·ClH

InChI: InChI=1S/C4H9N5.ClH/c1-5-3-4-6-7-8-9(4)2;/h5H,3H2,1-2H3;1H

InChI key: InChIKey=RKUPMKQOZMPDJK-UHFFFAOYSA-N

SMILES: C(NC)C=1N(C)N=NN1.Cl

Synonyms:

• 1H-Tetrazole-5-methanamine, N,1-dimethyl-, hydrochloride (1:1)

Methyl[(1-methyl-1H-1,2,3,4-tetrazol-5-yl)methyl]amine hydrochloride

CAS: 1384429-04-2

Versatile small molecule scaffold

Formula: C₄H₁₀ClN₅

Purity: Min. 95%

Molecular weight: 163.61 g/mol

Ref: 3D-JFC42904