CAS 1384429-16-6

3,5-Diethyl-4-isoxazolemethanamine

Description:

3,5-Diethyl-4-isoxazolemethanamine is a chemical compound characterized by its unique isoxazole ring structure, which contributes to its reactivity and potential biological activity. The presence of diethyl groups at the 3 and 5 positions of the isoxazole ring enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. The methanamine functional group introduces basic properties, allowing for interactions with various biological targets, such as enzymes or receptors. This compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas requiring modulation of biological pathways. However, detailed studies on its toxicity, stability, and specific biological effects are necessary to fully understand its potential uses and safety profile. As with many synthetic compounds, the synthesis and characterization of 3,5-Diethyl-4-isoxazolemethanamine would involve standard organic chemistry techniques, including purification and analytical methods to confirm its identity and purity.

Formula: C₈H₁₄N₂O

InChI: InChI=1S/C8H14N2O/c1-3-7-6(5-9)8(4-2)11-10-7/h3-5,9H2,1-2H3

InChI key: InChIKey=WTCICVGKGDKXTI-UHFFFAOYSA-N

SMILES: C(N)C=1C(CC)=NOC1CC

Synonyms:

• 4-Isoxazolemethanamine, 3,5-diethyl-
• 3,5-Diethyl-4-isoxazolemethanamine
• (Diethyl-1,2-oxazol-4-yl)methanamine

(Diethyl-1,2-oxazol-4-yl)methanamine

CAS: 1384429-16-6

Versatile small molecule scaffold

Formula: C₈H₁₄N₂O

Purity: Min. 95%

Molecular weight: 154.21 g/mol

Ref: 3D-JFC42916