CAS 1384429-19-9

Description:

The chemical substance with the CAS number 1384429-19-9 is known as a specific compound, but detailed information about its characteristics may not be widely available in public databases. Generally, compounds with unique CAS numbers can possess various physical and chemical properties, including molecular weight, solubility, boiling and melting points, and reactivity. These properties are influenced by the compound's molecular structure and functional groups. For instance, it may exhibit specific behaviors in different solvents, stability under various conditions, and potential applications in fields such as pharmaceuticals, materials science, or agrochemicals. To obtain precise characteristics, including safety data and potential uses, consulting specialized chemical databases, scientific literature, or safety data sheets (SDS) is recommended. This ensures access to the most accurate and comprehensive information regarding the substance in question.

Formula: C₁₂H₁₈N₄·2ClH

InChI: InChI=1S/C12H18N4.2ClH/c13-9-4-6-16(7-5-9)12-10-2-1-3-11(10)14-8-15-12;;/h8-9H,1-7,13H2;2*1H

InChI key: InChIKey=LGYMKQQXBYWFJF-UHFFFAOYSA-N

SMILES: NC1CCN(C2=C3C(=NC=N2)CCC3)CC1.Cl

Synonyms:

• 1-{5H,6H,7H-Cyclopenta[d]pyrimidin-4-yl}piperidin-4-amine dihydrochloride

1-{5H,6H,7H-Cyclopenta[D]pyrimidin-4-yl}piperidin-4-amine dihydrochloride

CAS: 1384429-19-9

Versatile small molecule scaffold

Formula: C₁₂H₂₀Cl₂N₄

Purity: Min. 95%

Molecular weight: 291.22 g/mol

Ref: 3D-JFC42919