CAS 1384429-33-7

Pyridine, 2-(2H-tetrazol-5-ylmethyl)-, hydrochloride (1:2)

Description:

Pyridine, 2-(2H-tetrazol-5-ylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyridine and tetrazole functional groups. It typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, which is indicative of its polar nature due to the presence of the hydrochloride moiety. The compound is often utilized in pharmaceutical research and development due to its potential biological activity, particularly in medicinal chemistry. Its structure suggests that it may exhibit properties such as antimicrobial or anti-inflammatory effects, although specific biological activities would depend on further empirical studies. The presence of the tetrazole ring can enhance the compound's lipophilicity and bioavailability, making it a subject of interest in drug design. As with many chemical substances, proper handling and safety precautions are essential, as it may pose health risks if ingested or inhaled. Overall, this compound represents a unique combination of heterocyclic chemistry with potential applications in various fields.

Formula: C₇H₇N₅·2ClH

InChI: InChI=1S/C7H7N5.2ClH/c1-2-4-8-6(3-1)5-7-9-11-12-10-7;;/h1-4H,5H2,(H,9,10,11,12);2*1H

InChI key: InChIKey=HQJKEJDBKRFECI-UHFFFAOYSA-N

SMILES: C(C1=CC=CC=N1)C=2NN=NN2.Cl

Synonyms:

• Pyridine, 2-(2H-tetrazol-5-ylmethyl)-, hydrochloride (1:2)

2-(1H-1,2,3,4-Tetrazol-5-ylmethyl)pyridine dihydrochloride

CAS: 1384429-33-7

Versatile small molecule scaffold

Formula: C₇H₉Cl₂N₅

Purity: Min. 95%

Molecular weight: 234.1 g/mol

Ref: 3D-JFC42933