CAS 1384429-35-9: 2-Cyano-4-fluoro-6-methylbenzenesulfonyl chloride

Description: 2-Cyano-4-fluoro-6-methylbenzenesulfonyl chloride is an organic compound characterized by its sulfonyl chloride functional group, which is known for its reactivity in various chemical reactions, particularly in the formation of sulfonamides. The presence of a cyano group and a fluorine atom on the aromatic ring contributes to its unique electronic properties, making it a valuable intermediate in synthetic organic chemistry. This compound is typically a solid at room temperature and may exhibit moderate to high solubility in polar organic solvents. Its reactivity allows it to participate in nucleophilic substitution reactions, where the sulfonyl chloride can be converted into other functional groups. Additionally, the fluorine atom can influence the compound's stability and reactivity, while the cyano group can serve as a handle for further functionalization. Due to its specific structure, this compound may find applications in pharmaceuticals, agrochemicals, and materials science, although handling precautions are necessary due to the potential hazards associated with sulfonyl chlorides.

Formula: C₈H₅ClFNO₂S

InChI: InChI=1S/C8H5ClFNO2S/c1-5-2-7(10)3-6(4-11)8(5)14(9,12)13/h2-3H,1H3

InChI key: InChIKey=OWRQVRQJLXABNC-UHFFFAOYSA-N

SMILES: N#CC1=CC(F)=CC(=C1S(=O)(=O)Cl)C

Synonyms:

• Benzenesulfonyl chloride, 2-cyano-4-fluoro-6-methyl-
• 2-Cyano-4-fluoro-6-methylbenzenesulfonyl chloride

2-Cyano-4-fluoro-6-methylbenzene-1-sulfonyl chloride

CAS: 1384429-35-9

Versatile small molecule scaffold

• Formula: C₈H₅ClFNO₂S
• Purity: Min. 95%
• Molecular weight: 233.65 g/mol