CAS 1384429-56-4

2H-Pyran-4-amine, N-(2,2-difluoroethyl)tetrahydro-, hydrochloride (1:1)

Description:

2H-Pyran-4-amine, N-(2,2-difluoroethyl)tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a pyran ring and an amine functional group. The presence of the difluoroethyl substituent introduces significant polarity and potential reactivity, making it of interest in medicinal chemistry and drug development. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability for pharmaceutical applications. The compound's molecular structure suggests potential interactions with biological targets, which may be explored in the context of therapeutic efficacy. Additionally, the difluoroethyl group may influence the compound's pharmacokinetics and pharmacodynamics, potentially affecting its absorption, distribution, metabolism, and excretion. Safety and handling considerations are essential, as with any chemical substance, particularly those with amine functionalities, which can be reactive. Overall, this compound represents a class of molecules that may have valuable applications in drug discovery and development.

Formula: C₇H₁₃F₂NO·ClH

InChI: InChI=1S/C7H13F2NO.ClH/c8-7(9)5-10-6-1-3-11-4-2-6;/h6-7,10H,1-5H2;1H

InChI key: InChIKey=UNQRTAXHDZAPRW-UHFFFAOYSA-N

SMILES: N(CC(F)F)C1CCOCC1.Cl

Synonyms:

• 2H-Pyran-4-amine, N-(2,2-difluoroethyl)tetrahydro-, hydrochloride (1:1)

N-(2,2-Difluoroethyl)oxan-4-amine hydrochloride

CAS: 1384429-56-4

Versatile small molecule scaffold

Formula: C₇H₁₄ClF₂NO

Purity: Min. 95%

Molecular weight: 201.64 g/mol

Ref: 3D-JFC42956