CAS 1384429-73-5

Benzothiazole, 2-(3-azetidinyl)-, hydrochloride (1:2)

Description:

Benzothiazole, 2-(3-azetidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its unique structure, which includes a benzothiazole moiety and an azetidine ring. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form. The benzothiazole structure contributes to its potential biological activity, often associated with various pharmacological properties, including antimicrobial and anti-inflammatory effects. The azetidine ring may enhance its interaction with biological targets, making it of interest in medicinal chemistry. The hydrochloride form improves its stability and solubility, facilitating its use in pharmaceutical formulations. As with many compounds, safety and handling precautions are essential, as it may exhibit toxicity or irritant properties. Overall, this compound represents a class of heterocyclic compounds that are valuable in drug development and research.

Formula: C₁₀H₁₀N₂S·2ClH

InChI: InChI=1S/C10H10N2S.2ClH/c1-2-4-9-8(3-1)12-10(13-9)7-5-11-6-7;;/h1-4,7,11H,5-6H2;2*1H

InChI key: InChIKey=XGLIPYJNKVTCGX-UHFFFAOYSA-N

SMILES: C1(=NC=2C(S1)=CC=CC2)C3CNC3.Cl

Synonyms:

• Benzothiazole, 2-(3-azetidinyl)-, hydrochloride (1:2)

2-(Azetidin-3-yl)-1,3-benzothiazole dihydrochloride

CAS: 1384429-73-5

Versatile small molecule scaffold

Formula: C₁₀H₁₂Cl₂N₂S

Purity: Min. 95%

Molecular weight: 263.19 g/mol

Ref: 3D-JFC42973