CAS 1384429-79-1

Methyl 6-chloro-3-(chlorosulfonyl)-2-pyridinecarboxylate

Description:

Methyl 6-chloro-3-(chlorosulfonyl)-2-pyridinecarboxylate is a chemical compound characterized by its pyridine ring structure, which is substituted at specific positions with a methyl ester, a chlorine atom, and a chlorosulfonyl group. This compound typically exhibits properties associated with both aromatic and aliphatic compounds, including potential reactivity due to the presence of the chlorosulfonyl group, which can act as a strong electrophile. The chlorine substituent can influence the compound's polarity and solubility in various solvents. Methyl 6-chloro-3-(chlorosulfonyl)-2-pyridinecarboxylate may be utilized in organic synthesis and pharmaceutical applications, particularly in the development of biologically active molecules. Its reactivity profile suggests it could participate in nucleophilic substitution reactions, making it a valuable intermediate in the synthesis of more complex chemical entities. Safety precautions should be observed when handling this compound due to its potential toxicity and reactivity.

Formula: C₇H₅Cl₂NO₄S

InChI: InChI=1S/C7H5Cl2NO4S/c1-14-7(11)6-4(15(9,12)13)2-3-5(8)10-6/h2-3H,1H3

InChI key: InChIKey=FKMZBYYOKDMNEA-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C1=C(C(OC)=O)N=C(Cl)C=C1

Synonyms:

• 2-Pyridinecarboxylic acid, 6-chloro-3-(chlorosulfonyl)-, methyl ester
• Methyl 6-chloro-3-(chlorosulfonyl)-2-pyridinecarboxylate

Methyl 6-chloro-3-(chlorosulfonyl)pyridine-2-carboxylate

CAS: 1384429-79-1

Versatile small molecule scaffold

Formula: C₇H₅Cl₂NO₄S

Purity: Min. 95%

Molecular weight: 270.09 g/mol

Ref: 3D-JFC42979