CAS 1384429-92-8

3-Iodoimidazo[1,2-a]pyridine-8-carboxylic acid

Description:

3-Iodoimidazo[1,2-a]pyridine-8-carboxylic acid is a heterocyclic compound characterized by the presence of both an imidazole and a pyridine ring, which contributes to its unique chemical properties. The presence of the iodine atom at the 3-position of the imidazole ring enhances its reactivity and can influence its biological activity. The carboxylic acid functional group at the 8-position provides acidic properties, allowing for potential interactions in various chemical environments, including hydrogen bonding and coordination with metal ions. This compound is typically used in medicinal chemistry and research due to its potential pharmacological applications, particularly in the development of novel therapeutic agents. Its structural features may also allow for diverse synthetic modifications, making it a valuable intermediate in organic synthesis. Additionally, the compound's solubility and stability can vary depending on the solvent and conditions, which is important for its application in biological systems or as a reagent in chemical reactions.

Formula: C₈H₅IN₂O₂

InChI: InChI=1S/C8H5IN2O2/c9-6-4-10-7-5(8(12)13)2-1-3-11(6)7/h1-4H,(H,12,13)

InChI key: InChIKey=BJXADZFBNVUZMS-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2N(C(I)=CN2)C=CC1

Synonyms:

• Imidazo[1,2-a]pyridine-8-carboxylic acid, 3-iodo-
• 3-Iodoimidazo[1,2-a]pyridine-8-carboxylic acid

3-Iodoimidazo[1,2-a]pyridine-8-carboxylic acid

CAS: 1384429-92-8

Versatile small molecule scaffold

Formula: C₈H₅IN₂O₂

Purity: Min. 95%

Molecular weight: 288.04 g/mol

Ref: 3D-JFC42992