CAS 1384429-93-9

1,2,4-Oxadiazole-3-methanamine, 5-(4-chlorophenyl)-α-methyl-, hydrochloride (1:1)

Description:

1,2,4-Oxadiazole-3-methanamine, 5-(4-chlorophenyl)-α-methyl-, hydrochloride (1:1) is a chemical compound characterized by its oxadiazole ring structure, which contributes to its potential biological activity. The presence of the 4-chlorophenyl group enhances its lipophilicity, potentially influencing its interaction with biological targets. The α-methyl group may affect the compound's steric properties and reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in pharmaceutical applications. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and stability, would depend on the conditions under which it is synthesized and stored. Safety data, including toxicity and handling precautions, should be reviewed before use, as with any chemical substance. Overall, this compound represents a class of heterocyclic compounds that are often explored for their potential therapeutic applications.

Formula: C₁₀H₁₀ClN₃O·ClH

InChI: InChI=1S/C10H10ClN3O.ClH/c1-6(12)9-13-10(15-14-9)7-2-4-8(11)5-3-7;/h2-6H,12H2,1H3;1H

InChI key: InChIKey=QRWMNZDNOCGEJK-UHFFFAOYSA-N

SMILES: C(C)(N)C=1N=C(ON1)C2=CC=C(Cl)C=C2.Cl

Synonyms:

• 1,2,4-Oxadiazole-3-methanamine, 5-(4-chlorophenyl)-α-methyl-, hydrochloride (1:1)

1-[5-(4-Chlorophenyl)-1,2,4-oxadiazol-3-yl]ethan-1-amine hydrochloride

CAS: 1384429-93-9

Versatile small molecule scaffold

Formula: C₁₀H₁₁Cl₂N₃O

Purity: Min. 95%

Molecular weight: 260.12 g/mol

Ref: 3D-JFC42993