CAS 1384429-94-0

1,1-Dimethylethyl 3-[2-oxo-2-(1-pyrrolidinyl)ethoxy]-1-pyrrolidinecarboxylate

Description:

1,1-Dimethylethyl 3-[2-oxo-2-(1-pyrrolidinyl)ethoxy]-1-pyrrolidinecarboxylate, identified by its CAS number 1384429-94-0, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and an ethoxy group. This compound features a tert-butyl group, which contributes to its steric bulk and may influence its reactivity and solubility. The presence of the 2-oxo group suggests potential for reactivity typical of carbonyl compounds, while the pyrrolidine moieties may impart specific biological activity or pharmacological properties. The compound's molecular structure indicates it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, making it essential to consider these factors in practical applications. Overall, this compound exemplifies the intricate interplay of functional groups that can lead to diverse chemical behaviors and potential applications in various fields, including drug development and organic synthesis.

Formula: C₁₅H₂₆N₂O₄

InChI: InChI=1S/C15H26N2O4/c1-15(2,3)21-14(19)17-9-6-12(10-17)20-11-13(18)16-7-4-5-8-16/h12H,4-11H2,1-3H3

InChI key: InChIKey=PQUJOPWQZWYPGV-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC(OCC(=O)N2CCCC2)CC1

Synonyms:

• 1,1-Dimethylethyl 3-[2-oxo-2-(1-pyrrolidinyl)ethoxy]-1-pyrrolidinecarboxylate
• 1-Pyrrolidinecarboxylic acid, 3-[2-oxo-2-(1-pyrrolidinyl)ethoxy]-, 1,1-dimethylethyl ester

tert-Butyl 3-[2-oxo-2-(pyrrolidin-1-yl)ethoxy]pyrrolidine-1-carboxylate

CAS: 1384429-94-0

Versatile small molecule scaffold

Formula: C₁₅H₂₆N₂O₄

Purity: Min. 95%

Molecular weight: 298.38 g/mol

Ref: 3D-JFC42994