CAS 1384430-02-7

Pyrrolidine, 2-[(3,4-dimethoxyphenyl)methyl]-, hydrochloride (1:1)

Description:

Pyrrolidine, 2-[(3,4-dimethoxyphenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of the 3,4-dimethoxyphenyl group indicates that it has two methoxy substituents on a phenyl ring, contributing to its potential biological activity and solubility properties. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. This compound may exhibit various pharmacological effects due to its structural features, making it of interest in medicinal chemistry. Its molecular interactions can be influenced by the presence of the methoxy groups, which can affect lipophilicity and receptor binding. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies would be necessary to fully elucidate its properties, including its reactivity, stability, and potential therapeutic applications.

Formula: C₁₃H₁₉NO₂·ClH

InChI: InChI=1S/C13H19NO2.ClH/c1-15-12-6-5-10(9-13(12)16-2)8-11-4-3-7-14-11;/h5-6,9,11,14H,3-4,7-8H2,1-2H3;1H

InChI key: InChIKey=FSCFXDQGPDHWHC-UHFFFAOYSA-N

SMILES: O(C)C1=C(OC)C=CC(CC2CCCN2)=C1.Cl

Synonyms:

• Pyrrolidine, 2-[(3,4-dimethoxyphenyl)methyl]-, hydrochloride (1:1)

2-[(3,4-Dimethoxyphenyl)methyl]pyrrolidine hydrochloride

Controlled Product

CAS: 1384430-02-7

Versatile small molecule scaffold

Formula: C₁₃H₂₀ClNO₂

Purity: Min. 95%

Molecular weight: 257.75 g/mol

Ref: 3D-JFC43002