CAS 1384430-25-4

1H-Benzimidazol-6-amine, N,2-dimethyl-, hydrochloride (1:2)

Description:

1H-Benzimidazol-6-amine, N,2-dimethyl-, hydrochloride (1:2) is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features a dimethyl substitution at the nitrogen atom in the 2-position and an amino group at the 6-position of the benzimidazole ring. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical formulations. The presence of the amino group suggests potential basic properties, while the benzimidazole structure is often associated with biological activity, including antimicrobial and anticancer properties. The compound's molecular interactions may involve hydrogen bonding and π-π stacking due to its aromatic nature. As with many benzimidazole derivatives, it may serve as a scaffold for drug development, particularly in targeting specific biological pathways. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings.

Formula: C₉H₁₁N₃.2ClH

InChI: InChI=1S/C9H11N3.2ClH/c1-6-11-8-4-3-7(10-2)5-9(8)12-6;;/h3-5,10H,1-2H3,(H,11,12);2*1H

InChI key: InChIKey=JRHFAVXRAIOKDH-UHFFFAOYSA-N

SMILES: CC=1NC=2C(=CC(NC)=CC2)N1.Cl

N,2-Dimethyl-1H-1,3-benzodiazol-5-amine dihydrochloride

CAS: 1384430-25-4

Versatile small molecule scaffold

Formula: C₉H₁₃Cl₂N₃

Purity: Min. 95%

Molecular weight: 234.12 g/mol

Ref: 3D-JFC43025