CAS 1384430-45-8

Cyclopropanemethanamine, 1-(2-methylpropyl)-, hydrochloride (1:1)

Description:

Cyclopropanemethanamine, 1-(2-methylpropyl)-, hydrochloride (1:1) is a chemical compound characterized by its unique cyclopropane structure, which contributes to its reactivity and potential applications in organic synthesis. The presence of the amine functional group indicates that it can act as a base and participate in various chemical reactions, including nucleophilic substitutions. The hydrochloride form suggests that the compound is a salt, which typically enhances its solubility in water and stability. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure includes a cyclopropane ring attached to a propyl group, which can influence its steric and electronic properties. The CAS number 1384430-45-8 provides a unique identifier for this substance, facilitating its identification in chemical databases and literature. Overall, the characteristics of this compound make it a subject of interest in both synthetic chemistry and potential therapeutic applications.

Formula: C₈H₁₇N·ClH

InChI: InChI=1S/C8H17N.ClH/c1-7(2)5-8(6-9)3-4-8;/h7H,3-6,9H2,1-2H3;1H

InChI key: InChIKey=DCTFWZNHGSMNSH-UHFFFAOYSA-N

SMILES: C(C(C)C)C1(CN)CC1.Cl

Synonyms:

• Cyclopropanemethanamine, 1-(2-methylpropyl)-, hydrochloride (1:1)

[1-(2-Methylpropyl)cyclopropyl]methanamine hydrochloride

CAS: 1384430-45-8

Versatile small molecule scaffold

Formula: C₈H₁₈ClN

Purity: Min. 95%

Molecular weight: 163.69 g/mol

Ref: 3D-JFC43045