CAS 1384430-51-6

Cyclohexanamine, 4-(1,2,4-oxadiazol-5-yl)-, hydrochloride (1:1)

Description:

Cyclohexanamine, 4-(1,2,4-oxadiazol-5-yl)-, hydrochloride (1:1) is a chemical compound characterized by its cyclohexanamine backbone substituted with a 1,2,4-oxadiazole moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The oxadiazole ring contributes to its potential biological activity, making it of interest in pharmaceutical research. The presence of the amine group allows for hydrogen bonding, which can influence its interaction with biological targets. As with many nitrogen-containing heterocycles, it may exhibit properties such as antimicrobial or anti-inflammatory activities, although specific biological effects would depend on further empirical studies. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₈H₁₃N₃O·ClH

InChI: InChI=1S/C8H13N3O.ClH/c9-7-3-1-6(2-4-7)8-10-5-11-12-8;/h5-7H,1-4,9H2;1H

InChI key: InChIKey=ZTWZLUUTZCTIBV-UHFFFAOYSA-N

SMILES: NC1CCC(CC1)C2=NC=NO2.Cl

Synonyms:

• Cyclohexanamine, 4-(1,2,4-oxadiazol-5-yl)-, hydrochloride (1:1)

4-(1,2,4-Oxadiazol-5-yl)cyclohexan-1-amine hydrochloride

CAS: 1384430-51-6

Versatile small molecule scaffold

Formula: C₈H₁₄ClN₃O

Purity: Min. 95%

Molecular weight: 203.67 g/mol

Ref: 3D-JFC43051