CAS 1384430-52-7

1H-1,2,4-Triazole-3-ethanamine, 1-methyl-, hydrochloride (1:1)

Description:

1H-1,2,4-Triazole-3-ethanamine, 1-methyl-, hydrochloride (1:1) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. The triazole moiety contributes to its potential biological activity, making it of interest in pharmaceutical research, particularly in the development of antifungal and antimicrobial agents. The presence of the ethylamine side chain enhances its reactivity and interaction with biological targets. As a hydrochloride salt, it exhibits improved stability and solubility compared to its free base form. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound's unique structural features and solubility profile make it a valuable candidate for various applications in medicinal chemistry.

Formula: C₅H₁₀N₄·ClH

InChI: InChI=1S/C5H10N4.ClH/c1-9-4-7-5(8-9)2-3-6;/h4H,2-3,6H2,1H3;1H

InChI key: InChIKey=VOEFSWLIXXOWDF-UHFFFAOYSA-N

SMILES: C(CN)C1=NN(C)C=N1.Cl

Synonyms:

• 1H-1,2,4-Triazole-3-ethanamine, 1-methyl-, hydrochloride (1:1)

2-(1-Methyl-1H-1,2,4-triazol-3-yl)ethan-1-amine hydrochloride

CAS: 1384430-52-7

Versatile small molecule scaffold

Formula: C₅H₁₁ClN₄

Purity: Min. 95%

Molecular weight: 162.62 g/mol

Ref: 3D-JFC43052