CAS 1384430-62-9

Cyclopropanemethanamine, N-(2,2-difluoroethyl)-, hydrochloride (1:1)

Description:

Cyclopropanemethanamine, N-(2,2-difluoroethyl)-, hydrochloride (1:1) is a chemical compound characterized by its unique cyclopropane structure combined with an amine functional group. The presence of the difluoroethyl substituent introduces significant polarity and potential reactivity, which can influence its biological activity and solubility. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The compound's molecular structure suggests it may exhibit interesting pharmacological properties, potentially acting as a ligand or inhibitor in biological systems. Its specific interactions and effects would depend on the context of its use, including concentration and the biological environment. Safety data and handling precautions should be considered, as with any chemical, particularly due to the presence of fluorine atoms, which can impart unique toxicological profiles. Overall, this compound represents a class of amines that may have potential applications in medicinal chemistry and related fields.

Formula: C₆H₁₁F₂N·ClH

InChI: InChI=1S/C6H11F2N.ClH/c7-6(8)4-9-3-5-1-2-5;/h5-6,9H,1-4H2;1H

InChI key: InChIKey=IEILUWXDFAXQNZ-UHFFFAOYSA-N

SMILES: C(NCC(F)F)C1CC1.Cl

Synonyms:

• Cyclopropanemethanamine, N-(2,2-difluoroethyl)-, hydrochloride (1:1)
• (Cyclopropylmethyl)(2,2-difluoroethyl)amine hydrochloride

(Cyclopropylmethyl)(2,2-difluoroethyl)amine hydrochloride

CAS: 1384430-62-9

Versatile small molecule scaffold

Formula: C₆H₁₂ClF₂N

Purity: Min. 95%

Molecular weight: 171.61 g/mol

Ref: 3D-JFC43062