CAS 1384430-77-6

1,2,4-Triazolo[4,3-a]pyrimidine-3-methanamine, α-methyl-, hydrochloride (1:1)

Description:

1,2,4-Triazolo[4,3-a]pyrimidine-3-methanamine, α-methyl-, hydrochloride (1:1) is a chemical compound characterized by its unique triazole and pyrimidine ring structures, which contribute to its potential biological activity. This compound features a methanamine group and an α-methyl substituent, enhancing its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications in pharmaceutical research. The presence of the triazole moiety often indicates potential for antimicrobial or antifungal properties, while the pyrimidine component may be involved in nucleic acid interactions. The compound's molecular structure suggests it could act as a ligand in biological systems, potentially influencing enzyme activity or receptor binding. Its CAS number, 1384430-77-6, allows for precise identification in chemical databases, facilitating research and development in medicinal chemistry. Overall, this compound represents a class of heterocyclic compounds that are of interest for their pharmacological properties and potential therapeutic applications.

Formula: C₇H₉N₅·ClH

InChI: InChI=1S/C7H9N5.ClH/c1-5(8)6-10-11-7-9-3-2-4-12(6)7;/h2-5H,8H2,1H3;1H

InChI key: InChIKey=CKCVBSFUEBZVOH-UHFFFAOYSA-N

SMILES: C(C)(N)C=1N2C(=NN1)N=CC=C2.Cl

Synonyms:

• 1,2,4-Triazolo[4,3-a]pyrimidine-3-methanamine, α-methyl-, hydrochloride (1:1)

1-{[1,2,4]Triazolo[4,3-a]pyrimidin-3-yl}ethan-1-amine hydrochloride

CAS: 1384430-77-6

Versatile small molecule scaffold

Formula: C₇H₁₀ClN₅

Purity: Min. 95%

Molecular weight: 199.64 g/mol

Ref: 3D-JFC43077