CAS 1384431-11-1
:Thiomorpholine, 2,2-dimethyl-, 1-oxide
Description:
Thiomorpholine, 2,2-dimethyl-, 1-oxide is a heterocyclic organic compound characterized by a thiomorpholine ring structure, which includes a sulfur atom in place of one of the nitrogen atoms typically found in morpholine. This compound features a dimethyl substitution at the 2-position of the ring, contributing to its unique chemical properties. As an oxide, it possesses a stable oxygen atom bonded to the sulfur, which can influence its reactivity and interactions with other chemical species. Thiomorpholine derivatives are often studied for their potential applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The presence of the sulfur atom can impart distinctive characteristics such as increased nucleophilicity and the ability to participate in various chemical reactions, including oxidation and reduction processes. Additionally, the steric hindrance introduced by the dimethyl groups may affect the compound's solubility and reactivity. Overall, thiomorpholine, 2,2-dimethyl-, 1-oxide is of interest in both theoretical and applied chemistry contexts.
Formula:C6H13NOS
InChI:InChI=1S/C6H13NOS/c1-6(2)5-7-3-4-9(6)8/h7H,3-5H2,1-2H3
InChI key:InChIKey=BUXUIHPTHLOVAH-UHFFFAOYSA-N
SMILES:O=S1C(C)(C)CNCC1
Synonyms:- 2,2-Dimethyl-1λ4-thiomorpholin-1-one
- Thiomorpholine, 2,2-dimethyl-, 1-oxide
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery