CAS 1384431-21-3

Methanesulfonamide, N-[2-(aminomethyl)cyclopentyl]-, hydrochloride (1:1)

Description:

Methanesulfonamide, N-[2-(aminomethyl)cyclopentyl]-, hydrochloride (1:1) is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a cyclopentyl structure with an aminomethyl substituent, contributing to its potential biological activity. The hydrochloride form indicates that it is a salt, which often enhances solubility in water and may influence its pharmacokinetic properties. The presence of the methanesulfonamide moiety suggests that it may exhibit properties similar to other sulfonamides, such as acting as a competitive inhibitor of certain enzymes. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its molecular interactions, stability, and reactivity can be influenced by the cyclopentyl group and the sulfonamide linkage, making it a candidate for further research in drug development and therapeutic applications. As with many chemical substances, safety and handling precautions are essential due to potential toxicity and reactivity.

Formula: C₇H₁₆N₂O₂S·ClH

InChI: InChI=1S/C7H16N2O2S.ClH/c1-12(10,11)9-7-4-2-3-6(7)5-8;/h6-7,9H,2-5,8H2,1H3;1H

InChI key: InChIKey=JMEJTUZKOXONFA-UHFFFAOYSA-N

SMILES: N(S(C)(=O)=O)C1C(CN)CCC1.Cl

Synonyms:

• Methanesulfonamide, N-[2-(aminomethyl)cyclopentyl]-, hydrochloride (1:1)

N-[2-(Aminomethyl)cyclopentyl]methanesulfonamide hydrochloride

CAS: 1384431-21-3

Versatile small molecule scaffold

Formula: C₇H₁₇ClN₂O₂S

Purity: Min. 95%

Molecular weight: 228.74 g/mol

Ref: 3D-JFC43121