CAS 1384431-33-7

1-Thia-4-azaspiro[5.5]undecane, 1,1-dioxide

Description:

1-Thia-4-azaspiro[5.5]undecane, 1,1-dioxide is a chemical compound characterized by its unique spirocyclic structure, which includes a sulfur atom (thia) and a nitrogen atom (aza) within its framework. This compound features a bicyclic arrangement that contributes to its rigidity and potential biological activity. The presence of the 1,1-dioxide functional group indicates that it contains two double-bonded oxygen atoms, which can influence its reactivity and solubility. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological properties. The spiro structure can enhance the compound's ability to interact with biological targets, making it a candidate for further research in drug development. Additionally, the specific arrangement of atoms and functional groups can affect the compound's physical properties, such as melting point, boiling point, and polarity, which are crucial for understanding its behavior in various chemical environments. Overall, 1-Thia-4-azaspiro[5.5]undecane, 1,1-dioxide represents a class of compounds that may exhibit interesting chemical and biological properties.

Formula: C₉H₁₇NO₂S

InChI: InChI=1S/C9H17NO2S/c11-13(12)7-6-10-8-9(13)4-2-1-3-5-9/h10H,1-8H2

InChI key: InChIKey=YOMJMEVABFAKSW-UHFFFAOYSA-N

SMILES: O=S1(=O)C2(CNCC1)CCCCC2

Synonyms:

• 1-Thia-4-azaspiro[5.5]undecane, 1,1-dioxide

1-​Thia-​4-​azaspiro[5.5]​undecane 1,​1-​dioxide

CAS: 1384431-33-7

Versatile small molecule scaffold

Formula: C₉H₁₇NO₂S

Purity: Min. 95%

Molecular weight: 203.3 g/mol

Ref: 3D-JFC43133