CAS 138479-47-7
:1-(2-Formylphenyl)pyrazole
Description:
1-(2-Formylphenyl)pyrazole, identified by its CAS number 138479-47-7, is an organic compound characterized by the presence of both a pyrazole ring and a formyl group attached to a phenyl moiety. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and dichloromethane, but may have limited solubility in water. The presence of the formyl group suggests that it can participate in various chemical reactions, including condensation and oxidation, making it a versatile intermediate in organic synthesis. Additionally, the pyrazole ring contributes to its potential biological activity, as pyrazole derivatives are known for their diverse pharmacological properties. The compound's structure allows for potential interactions with biological targets, which may be explored in medicinal chemistry. Overall, 1-(2-Formylphenyl)pyrazole serves as an important building block in the synthesis of more complex organic molecules and may have applications in pharmaceuticals and agrochemicals.
Formula:C10H8N2O
InChI:InChI=1/C10H8N2O/c13-8-9-4-1-2-5-10(9)12-7-3-6-11-12/h1-8H
SMILES:c1ccc(c(c1)C=O)n1cccn1
Synonyms:- 2-Pyrazol-1-Yl-Benzaldehyde
- 2-(1H-Pyrazol-1-Yl)Benzaldehyde
- 2-(1H-Pyrazol-1-yl)benzaldehyde 95%
- 2-Pyrazol-1-Yl-Benzaldehyde, 95+%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzaldehyde, 2-(1H-pyrazol-1-yl)-
CAS:Formula:C10H8N2OPurity:97%Color and Shape:SolidMolecular weight:172.18332-(1H-Pyrazol-1-yl)benzaldehyde
CAS:2-(1H-Pyrazol-1-yl)benzaldehydeFormula:C10H8N2OPurity:95%Color and Shape: off white crystals/ powderMolecular weight:172.18g/mol2-(1H-Pyrazol-1-yl)benzaldehyde
CAS:2-(1H-Pyrazol-1-yl)benzaldehyde is a synthetic chemical compound that is used in the preparation of coupling reactions. It has been shown to be an efficient reagent for the synthesis of 2-bromobenzaldehyde and pyrazole. The molecule has a hydrazone attack, which can be coupled with 2-bromobenzaldehyde, with or without the use of an additional base such as sodium methoxide. This reaction can be carried out at room temperature and does not require any harsh conditions. 2-(1H-Pyrazol-1-yl)benzaldehyde also belongs to the family of aldehydes, which are molecules containing a carbon group that is connected to two hydrogen groups (i.e., RCH=O). Hydrogenation of this type of molecule gives rise to alcohols (RCHOH).Formula:C10H8N2OPurity:Min. 95%Molecular weight:172.18 g/mol



