CymitQuimica logo

CAS 138487-20-4

:

3-Butyn-1-ol, 4-(3-pyridinyl)- (9CI)

Description:
3-Butyn-1-ol, 4-(3-pyridinyl)-, with the CAS number 138487-20-4, is an organic compound characterized by its alkyne and alcohol functional groups. It features a butynol backbone, which includes a triple bond between the first and second carbon atoms, and a hydroxyl (-OH) group at the terminal position, indicating its classification as an alcohol. The presence of a pyridine ring, specifically a 3-pyridinyl substituent, adds to its complexity and may influence its chemical reactivity and biological activity. This compound is likely to exhibit polar characteristics due to the hydroxyl group, which can engage in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the alkyne functionality can participate in various chemical reactions, such as addition reactions. The compound may have applications in pharmaceuticals or as an intermediate in organic synthesis, although specific uses would depend on its reactivity and the context of its application. Safety data and handling precautions should be considered, as with any chemical substance.
Formula:C9H9NO
InChI:InChI=1S/C9H9NO/c11-7-2-1-4-9-5-3-6-10-8-9/h3,5-6,8,11H,2,7H2
InChI key:GTWACVFJDRATJU-UHFFFAOYSA-N
SMILES:C1=CC(=CN=C1)C#CCCO
Found 4 products.