CAS 13849-90-6

Pomonic acid

Description:

Pomonic acid, with the CAS number 13849-90-6, is a naturally occurring organic compound classified as a carboxylic acid. It is primarily derived from certain species of fungi and has garnered interest due to its potential biological activities. Pomonic acid is characterized by its unique molecular structure, which includes a carboxyl group (-COOH) that imparts acidic properties. This compound is known for its role in various biochemical processes and may exhibit antimicrobial and antifungal properties, making it a subject of research in pharmacology and biochemistry. Its solubility in organic solvents and limited solubility in water are typical of many carboxylic acids, influencing its behavior in biological systems. Additionally, pomonic acid's stability under standard conditions allows for its study in various chemical reactions. Overall, pomonic acid represents a fascinating area of study within natural products chemistry, with potential applications in medicine and agriculture.

Formula: C₃₀H₄₆O₄

InChI: InChI=1S/C30H46O4/c1-18-10-15-30(24(32)33)17-16-27(5)19(23(30)29(18,7)34)8-9-21-26(4)13-12-22(31)25(2,3)20(26)11-14-28(21,27)6/h8,18,20-21,23,34H,9-17H2,1-7H3,(H,32,33)/t18-,20+,21-,23-,26+,27-,28-,29-,30+/m1/s1

InChI key: InChIKey=KQTSQSVDAUIWJH-OOPGADJZSA-N

SMILES: C(O)(=O)[C@]12[C@](C=3[C@@](C)(CC1)[C@@]4(C)[C@](CC3)([C@]5(C)[C@@](CC4)(C(C)(C)C(=O)CC5)[H])[H])([C@](C)(O)[C@H](C)CC2)[H]

Synonyms:

• 3-Oxo-19α-hydroxyurs-12-en-28-oic acid
• 19-Hydroxy-3-oxours-12-en-28-oic acid
• Urs-12-en-28-oic acid, 19-hydroxy-3-oxo-
• Urs-12-en-28-oic acid, 19α-hydroxy-3-oxo-
• Pomonic acid

Pomonic acid

CAS: 13849-90-6

Pomonic acid, a triterpenoid, inhibits cholesterol ester build-up and ACAT activity.

Formula: C₃₀H₄₆O₄

Color and Shape: Solid

Molecular weight: 470.68

Ref: TM-T75552

3-Oxopomolic acid

CAS: 13849-90-6

3-Oxopomolic acid is a triterpenoid compound, which is derived from natural plant sources, particularly from the Rosaceae family. It is an oxidized derivative of oleanolic acid, commonly found in various medicinal plants known for their bioactive properties.

Formula: C₃₀H₄₆O₄

Purity: Min. 95%

Molecular weight: 470.70 g/mol

Ref: 3D-NAA84990