CAS 13849-91-7
:Pomolic acid
Description:
Pomolic acid, with the CAS number 13849-91-7, is a triterpenoid compound primarily derived from various plant sources, particularly from the genus Malus, which includes apple species. This compound is characterized by its pentacyclic structure, which is typical of many triterpenoids, and it exhibits a range of biological activities, including anti-inflammatory and antioxidant properties. Pomolic acid has garnered interest in pharmacological research due to its potential therapeutic effects, including its ability to modulate cellular pathways and influence metabolic processes. Additionally, it may play a role in promoting skin health and has been studied for its effects on cancer cell lines. The compound is typically found in a solid state at room temperature and is soluble in organic solvents, making it suitable for various extraction and formulation processes in both research and potential medicinal applications. As with many natural products, further studies are necessary to fully elucidate its mechanisms of action and potential benefits in health and disease.
Formula:C30H48O4
InChI:InChI=1S/C30H48O4/c1-18-10-15-30(24(32)33)17-16-27(5)19(23(30)29(18,7)34)8-9-21-26(4)13-12-22(31)25(2,3)20(26)11-14-28(21,27)6/h8,18,20-23,31,34H,9-17H2,1-7H3,(H,32,33)/t18-,20+,21-,22+,23-,26+,27-,28-,29-,30+/m1/s1
InChI key:InChIKey=ZZTYPLSBNNGEIS-OPAXANQDSA-N
SMILES:C(O)(=O)[C@]12[C@](C=3[C@@](C)(CC1)[C@@]4(C)[C@](CC3)([C@]5(C)[C@@](CC4)(C(C)(C)[C@@H](O)CC5)[H])[H])([C@](C)(O)[C@H](C)CC2)[H]
Synonyms:- (3Beta)-3,19-Dihydroxyurs-12-En-28-Oic Acid
- (3β)-3,19-Dihydroxyurs-12-en-28-oic acid
- 19α-Hydroxyursolic acid
- 3β,19α-Dihydroxy Urs-12-en-28-oic acid
- Benthamic acid
- Pomolic acid
- Randialic acid A
- Urs-12-en-28-oic acid, 3,19-dihydroxy-, (3β)-
- Urs-12-en-28-oic acid, 3β,19-dihydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Urs-12-en-28-oic acid, 3,19-dihydroxy-, (3β)-
CAS:Formula:C30H48O4Purity:98%Color and Shape:SolidMolecular weight:472.6997Pomolic acid
CAS:Pomolic acid has anti-cancer, anti-inflammatory and apoptotic activities, it can induce apoptosis in SK-OV-3 cells, which is mediated by the mitochondrial-Formula:C30H48O4Purity:96.84% - 99.79%Color and Shape:SolidMolecular weight:472.7Pomolic Acid
CAS:Controlled ProductPomolic acid is a natural compound that belongs to the group of p-hydroxybenzoic acid. Pomolic acid has been shown to inhibit the activity of p-glycoprotein (P-gp) and induce apoptosis in HL60 cells. It also inhibits the proliferation of cancer cells by targeting the mitochondrial apoptosis pathway and inhibiting DNA synthesis. The mechanism of action is not fully understood, but it is thought that pomolic acid interacts with the enzyme polymerase chain reaction (PCR) to produce significant cytotoxic effects on cancer cells. Pomolic acid can be used as a selective inhibitor for PCR and as an anti-cancer drug.
Formula:C30H48O4Purity:Min. 95%Molecular weight:472.7 g/molRef: 3D-NAA84991
Discontinued product




