
CAS 1384956-55-1
:3-Bromo-4-chlorophenylboronic acid
Description:
3-Bromo-4-chlorophenylboronic acid is an organoboron compound characterized by the presence of both bromine and chlorine substituents on a phenyl ring, along with a boronic acid functional group. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the boronic acid moiety. The presence of the bromine and chlorine atoms introduces unique electronic properties, making it useful in various chemical reactions, particularly in Suzuki coupling reactions, which are pivotal in the synthesis of biaryl compounds. The boronic acid group allows for the formation of stable complexes with diols, enhancing its utility in organic synthesis and medicinal chemistry. Additionally, this compound may exhibit interesting biological activities, making it a candidate for further research in pharmaceutical applications. As with many organoboron compounds, it is essential to handle it with care, considering potential reactivity and toxicity.
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Boronic acid, B-(3-bromo-4-chlorophenyl)-
CAS:Formula:C6H5BBrClO2Purity:98%Color and Shape:SolidMolecular weight:235.27073-Bromo-4-chlorophenylboronic acid
CAS:3-Bromo-4-chlorophenylboronic acidPurity:≥95%Molecular weight:235.27g/mol


