CAS 13850-16-3: Tormentic acid
Description:Tormentic acid, with the CAS number 13850-16-3, is a naturally occurring triterpenoid compound primarily found in various plant species, particularly in the genus *Erythrina*. It is characterized by its pentacyclic structure, which contributes to its biological activity. This compound exhibits a range of pharmacological properties, including anti-inflammatory, antioxidant, and potential anticancer effects, making it of interest in medicinal chemistry and pharmacology. Tormentic acid is typically soluble in organic solvents but has limited solubility in water, which is common for many triterpenoids. Its chemical structure allows it to interact with various biological targets, influencing cellular pathways. Additionally, research into tormentic acid has highlighted its potential applications in herbal medicine and as a lead compound for drug development. Overall, tormentic acid represents a significant area of study due to its diverse biological activities and potential therapeutic benefits.
Formula:C30H48O5
InChI:InChI=1S/C30H48O5/c1-17-10-13-30(24(33)34)15-14-27(5)18(22(30)29(17,7)35)8-9-21-26(4)16-19(31)23(32)25(2,3)20(26)11-12-28(21,27)6/h8,17,19-23,31-32,35H,9-16H2,1-7H3,(H,33,34)/t17-,19-,20+,21-,22-,23+,26+,27-,28-,29-,30+/m1/s1
InChI key:InChIKey=OXVUXGFZHDKYLS-BLIWDXROSA-N
SMILES:O=C(O)C12CCC(C)C(O)(C)C2C3=CCC4C5(C)CC(O)C(O)C(C)(C)C5CCC4(C)C3(C)CC1
- Synonyms:
- (2α,3β)-2,3,19-Trihydroxyurs-12-en-28-oic acid
- 2α,19α-Dihydroxyursolic acid
- 2α,3β,19-Trihydroxyurs-12-en-28-oic acid
- 2α,3β,19α-Trihydroxyurs-12-en-28-oic acid
- Tormentic acid
- Tormentolic acid
- Urs-12-En-28-Oic Acid, 2,3,19-Trihydroxy-, (2Alpha,3Beta)-
- Urs-12-en-28-oic acid, 2,3,19-trihydroxy-, (2α,3β)-
- Urs-12-en-28-oic acid, 2α,3β,19-trihydroxy-
