CAS 138526-69-9
:5-Bromo-1,2,3-trifluorobenzene
Description:
5-Bromo-1,2,3-trifluorobenzene is an aromatic halogenated compound characterized by the presence of a bromine atom and three fluorine atoms attached to a benzene ring. The bromine is located at the 5-position, while the trifluoromethyl group is positioned at the 1, 2, and 3 positions of the benzene ring, contributing to its unique reactivity and properties. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It exhibits significant polarity due to the electronegative fluorine atoms, which can influence its solubility in various solvents and its interactions in chemical reactions. The presence of both bromine and fluorine makes it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, its structure allows for potential applications in materials science and as a building block for more complex chemical entities. Safety precautions should be taken when handling this compound, as halogenated aromatic compounds can be hazardous.
Formula:C6H2BrF3
InChI:InChI=1S/C6H2BrF3/c7-3-1-4(8)6(10)5(9)2-3/h1-2H
InChI key:InChIKey=HKJCELUUIFFSIN-UHFFFAOYSA-N
SMILES:FC1=C(F)C=C(Br)C=C1F
Synonyms:- 1,2,3-Trifluoro-5-bromobenzene
- 2,4-difluoro-N-methylaniline
- 3,4,5-Trifluoro Bromobenzene
- 3,4,5-Trifluoro-1-bromobenzene
- 3,4,5-Trifluorobromobenzene
- 3,4,5-Trifluorophenyl bromide
- 4-Bromo-1,2,6-trifluorobenzene
- 5-Bromo-1,2,3-trifluorobenzene
- Benzene, 5-bromo-1,2,3-trifluoro-
- 1-Bromo-3,4,5-trifluorobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
1-Bromo-3,4,5-trifluorobenzene
CAS:Formula:C6H2BrF3Purity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:210.985-Bromo-1,2,3-trifluorobenzene, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C6H2BrF3Purity:98%Color and Shape:Clear colorless to pale yellow, LiquidMolecular weight:210.98Benzene, 5-bromo-1,2,3-trifluoro-
CAS:Formula:C6H2BrF3Purity:98%Color and Shape:LiquidMolecular weight:210.9793Ref: IN-DA0019DE
5g22.00€10g26.00€1kg184.00€25g26.00€50g28.00€5kgTo inquire100g44.00€250g67.00€25kgTo inquire500g119.00€50kgTo inquire100kgTo inquire3,4,5-Trifluorobromobenzene
CAS:<p>3,4,5-Trifluorobromobenzene</p>Formula:C6H2BrF3Purity:99%Color and Shape: clear. colourless liquidMolecular weight:210.98g/mol1-Bromo-3,4,5-trifluorobenzene
CAS:Formula:C6H2BrF3Purity:99.0%Color and Shape:Liquid, Clear LiquidMolecular weight:210.9811-Bromo-3,4,5-trifluorobenzene
CAS:<p>1-Bromo-3,4,5-trifluorobenzene is a chemical compound that belongs to the trimethyl group. It is synthesized from cyclohexane by dehydration and chlorination. 1-Bromo-3,4,5-trifluorobenzene has been shown to have a redox potential of -0.76 V vs. Ag/AgCl and is therefore an electron donor in reactions with electron acceptors such as chloride or multi-walled carbon nanotubes. The synthesis process for this compound involves a Suzuki coupling reaction between bromine and phenylacetylene followed by hydrolysis of the resulting intermediate to produce 2-bromopropane. The final step in the synthetic process involves the treatment of the intermediate with hydrogen fluoride to yield 1-bromo-3,4,5-trifluorobenzene. This chemical can be used as an industrial solvent for organic sol</p>Formula:C6H2BrF3Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:210.98 g/mol






