
CAS 138529-04-1
:7-(3,5-Dihydroxyphenoxy)-3-(2,4,6-trihydroxyphenoxy)dibenzo[b,e][1,4]dioxin-1,2,6,8-tetrol
Description:
The chemical substance known as "7-(3,5-Dihydroxyphenoxy)-3-(2,4,6-trihydroxyphenoxy)dibenzo[b,e][1,4]dioxin-1,2,6,8-tetrol," with the CAS number 138529-04-1, is a complex organic compound characterized by its multi-hydroxylated phenolic structure. This compound features a dibenzo[dioxin] core, which is a fused bicyclic structure known for its stability and potential biological activity. The presence of multiple hydroxyl groups contributes to its hydrophilicity and may enhance its reactivity and interaction with biological systems. Such compounds are often studied for their potential roles in environmental chemistry, particularly in relation to their persistence and toxicity. The specific arrangement of hydroxyl groups on the phenoxy substituents can influence the compound's solubility, reactivity, and potential applications in fields such as medicinal chemistry or materials science. Overall, this substance exemplifies the intricate relationship between molecular structure and chemical properties, which is crucial for understanding its behavior in various chemical and biological contexts.
Formula:C24H16O13
InChI:InChI=1S/C24H16O13/c25-8-1-9(26)3-11(2-8)34-22-14(30)6-16-24(20(22)33)37-17-7-15(18(31)19(32)23(17)36-16)35-21-12(28)4-10(27)5-13(21)29/h1-7,25-33H
InChI key:InChIKey=FGIOHPMUNJGQTO-UHFFFAOYSA-N
SMILES:OC1=C2C(OC=3C(O2)=CC(OC4=C(O)C=C(O)C=C4O)=C(O)C3O)=CC(O)=C1OC5=CC(O)=CC(O)=C5
Synonyms:- Dibenzo[b,e][1,4]dioxin-1,2,6,8-tetrol, 7-(3,5-dihydroxyphenoxy)-3-(2,4,6-trihydroxyphenoxy)-
- Diphlorethohydroxycarmalol
- 7-(3,5-Dihydroxyphenoxy)-3-(2,4,6-trihydroxyphenoxy)dibenzo[b,e][1,4]dioxin-1,2,6,8-tetrol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Diphlorethohydroxycarmalol
CAS:<p>Diphlorethohydroxycarmalol is a useful organic compound for research related to life sciences and the catalog number is T125953.</p>Formula:C24H16O13Color and Shape:SolidMolecular weight:512.379
