CAS 138530-95-7
:(S)-Lansoprazole
Description:
(S)-Lansoprazole is a proton pump inhibitor primarily used to treat conditions such as gastroesophageal reflux disease (GERD) and peptic ulcers by reducing stomach acid production. It is characterized by its chiral nature, with the (S)-enantiomer being the active form that exhibits therapeutic effects. The compound has a complex structure featuring a benzimidazole ring, a pyridine ring, and a sulfinyl group, contributing to its pharmacological activity. (S)-Lansoprazole is typically administered orally and is known for its relatively rapid onset of action. It is metabolized in the liver, primarily through cytochrome P450 enzymes, leading to various metabolites. The substance is generally well-tolerated, though it may cause side effects such as headache, diarrhea, or abdominal pain in some patients. Its stability is influenced by factors such as pH and light exposure, necessitating careful storage conditions. Overall, (S)-Lansoprazole plays a significant role in managing acid-related disorders, showcasing the importance of chiral compounds in medicinal chemistry.
Formula:C16H14F3N3O2S
InChI:InChI=1/C16H14F3N3O2S/c1-10-13(20-7-6-14(10)24-9-16(17,18)19)8-25(23)15-21-11-4-2-3-5-12(11)22-15/h2-7H,8-9H2,1H3,(H,21,22)/t25-/m0/s1
SMILES:Cc1c(CS(=O)c2nc3ccccc3[nH]2)nccc1OCC(F)(F)F
Synonyms:- 1H-Benzimidazole, 2-[(S)-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]sulfinyl]- (9CI)
- 1H-Benzimidazole, 2-[[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]sulfinyl]-, (S)-
- Levolansoprazole
- 2-[(S)-[[3-Methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]sulfinyl]-1H-benzimidazole
- 2-[(S)-{[3-methyl-4-(2,2,2-trifluoroethoxy)pyridin-2-yl]methyl}sulfinyl]-1H-benzimidazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
1H-Benzimidazole, 2-[(S)-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]sulfinyl]-
CAS:Formula:C16H14F3N3O2SPurity:99%Color and Shape:SolidMolecular weight:369.3615Levolansoprazole
CAS:Levolansoprazole ((S)-Lansoprazole), a proton pump inhibitor, irreversibly inhibits H+/K+-stimulated ATPase pumps in parietal cells (IC50: 5.2 μM).Formula:C16H14F3N3O2SPurity:98.629%Color and Shape:SolidMolecular weight:369.36Ref: TM-T20714
1mg105.00€5mg234.00€1mL*10mM (DMSO)241.00€10mg326.00€25mg495.00€50mg655.00€100mg879.00€200mg1,161.00€(S)-Lansoprazole
CAS:Controlled ProductApplications The S-enantiomer of Lansoprazole; a gastric proton pump inhibitor. An antiulcerative.
References Figgitt, D., et al.: Drugs, 60, 925 (2000), Katsuki, H., et al.: Eur. J. Clin. Pharmacol., 57, 709 (2001), Barradell, L.B., et al.: Drugs, 44, 225 (1992), Kim, K., et al.: Clin. Pharmacol. Ther., 72, 90 (2002), Niioka, T., et al.: Ther. Drug Monit., 28, 321 (2006),Formula:C16H14F3N3O2SColor and Shape:NeatMolecular weight:369.36(S)-Lansoprazole
CAS:Gastric proton pump inhibitorFormula:C16H14F3N3O2SPurity:Min. 95%Color and Shape:White PowderMolecular weight:369.36 g/mol






