CAS 13855-80-6
:ethyl 4-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-2-oxobutanoate
Description:
Ethyl 4-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-2-oxobutanoate, with the CAS number 13855-80-6, is a chemical compound characterized by its complex structure, which includes an ethyl ester functional group and an isoindole moiety. This compound typically exhibits properties associated with both esters and diketones, making it potentially useful in various chemical reactions, including condensation and cyclization processes. The presence of the dioxo group suggests that it may participate in reactions typical of carbonyl compounds, such as nucleophilic addition or condensation. Its molecular structure indicates that it may have applications in organic synthesis, potentially serving as an intermediate in the production of pharmaceuticals or agrochemicals. Additionally, the compound's solubility and reactivity can be influenced by the presence of the ethyl group, which may enhance its lipophilicity. Overall, ethyl 4-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-2-oxobutanoate is a versatile compound with potential applications in various fields of chemistry.
Formula:C14H13NO5
InChI:InChI=1/C14H13NO5/c1-2-20-14(19)11(16)7-8-15-12(17)9-5-3-4-6-10(9)13(15)18/h3-6H,2,7-8H2,1H3
SMILES:CCOC(=O)C(=O)CCN1C(=O)c2ccccc2C1=O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Ethyl 4-(1,3-Dioxoisoindolin-2-yl-15N)-3-oxobutanoate-1,2,3,4-13C4
CAS:Controlled ProductFormula:C10C4H1315NO5Color and Shape:NeatMolecular weight:280.224-Phthalimidoacetoacetic Acid Ethyl Ester
CAS:Controlled ProductApplications 4-Phthalimidoacetoacetic Acid Ethyl Ester is an intermediate in the synthesis of 5-Aminolevulinic Acid-3-13C Hydrochloride which is a naturally occurring amino acid; precursor of tetrapyrroles in the biosynthesis of chlorophyll and heme. Antineoplastic (photosensitizer).
References Sisler, E.C., et al.: Physiol. Plant., 16, 315 (1963), Herdeis, C., et al.: Arch. Pharm., 317, 304 (1984), Peng, Q., et al.: Cancer, 79, 2282(1997),Formula:C14H13NO5Color and Shape:NeatMolecular weight:275.26ETHYL 4-(1,3-DIOXOISOINDOLIN-2-YL)-3-OXOBUTANOATE
CAS:Formula:C14H13NO5Purity:95.0%Molecular weight:275.26

