CAS 1385694-54-1

Methyl 1-(3-bromo-4-fluorophenyl)-4-oxocyclohexanecarboxylate

Description:

Methyl 1-(3-bromo-4-fluorophenyl)-4-oxocyclohexanecarboxylate is a chemical compound characterized by its complex structure, which includes a cyclohexane ring, a carboxylate ester functional group, and a substituted aromatic ring featuring both bromine and fluorine atoms. The presence of the bromine and fluorine substituents on the phenyl ring can influence the compound's reactivity and physical properties, such as solubility and boiling point. The oxo group contributes to the compound's potential as a reactive intermediate in various organic synthesis reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in the synthesis of more complex molecules or as a building block in pharmaceutical research. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₄H₁₄BrFO₃

InChI: InChI=1S/C14H14BrFO3/c1-19-13(18)14(6-4-10(17)5-7-14)9-2-3-12(16)11(15)8-9/h2-3,8H,4-7H2,1H3

InChI key: InChIKey=UMKFQIUGUWNJHW-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1(CCC(=O)CC1)C2=CC(Br)=C(F)C=C2

Synonyms:

• Cyclohexanecarboxylic acid, 1-(3-bromo-4-fluorophenyl)-4-oxo-, methyl ester
• Methyl 1-(3-bromo-4-fluorophenyl)-4-oxocyclohexanecarboxylate

Methyl 1-(3-Bromo-4-fluorophenyl)-4-oxocyclohexanecarboxylate

CAS: 1385694-54-1

Formula: C₁₄H₁₄BrFO₃

Molecular weight: 329.1616

Ref: IN-DA0018QM

Methyl 1-(3-Bromo-4-fluorophenyl)-4-oxocyclohexanecarboxylate

CAS: 1385694-54-1

Methyl 1-(3-Bromo-4-fluorophenyl)-4-oxocyclohexanecarboxylate

Purity: ≥95%

Molecular weight: 329.16g/mol

Ref: 54-PC510120