CAS 1385694-61-0: 1-(2-Chlorophenyl)-4-oxocyclohexanecarboxylic acid
Description:1-(2-Chlorophenyl)-4-oxocyclohexanecarboxylic acid is an organic compound characterized by its unique structure, which includes a cyclohexane ring substituted with a carboxylic acid group and a ketone functionality. The presence of a 2-chlorophenyl group enhances its chemical reactivity and potential biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many aromatic compounds. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, particularly due to the presence of functional groups that can participate in various chemical reactions. The compound may also exhibit specific stereochemical configurations, influencing its reactivity and interactions with biological targets. As with many organic compounds, safety and handling precautions are essential, as it may pose risks such as irritation or toxicity. Overall, 1-(2-Chlorophenyl)-4-oxocyclohexanecarboxylic acid represents a class of compounds that can be explored for diverse applications in chemical synthesis and medicinal chemistry.
Formula:C13H13ClO3
InChI:InChI=1S/C13H13ClO3/c14-11-4-2-1-3-10(11)13(12(16)17)7-5-9(15)6-8-13/h1-4H,5-8H2,(H,16,17)
InChI key:InChIKey=ZBDTUKWTMANXAU-UHFFFAOYSA-N
SMILES:O=C(O)C1(C=2C=CC=CC2Cl)CCC(=O)CC1
- Synonyms:
- Cyclohexanecarboxylic acid, 1-(2-chlorophenyl)-4-oxo-
- 1-(2-Chlorophenyl)-4-oxocyclohexanecarboxylic acid
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Cyclohexanecarboxylic acid, 1-(2-chlorophenyl)-4-oxo- REF: IN-DA0018QHCAS: 1385694-61-0 | - - - | To inquire | Mon 24 Mar 25 |
 | 1-(2-Chlorophenyl)-4-oxocyclohexanecarboxylic acid REF: 54-OR470532CAS: 1385694-61-0 | - - - | To inquire | Mon 31 Mar 25 |
 | 1-(2-Chlorophenyl)-4-oxocyclohexane-1-carboxylic acid REF: 10-F769318CAS: 1385694-61-0 | 98% | - - - | Discontinued product |
 | 1-(2-Chlorophenyl)-4-oxocyclohexanecarboxylic acid REF: 3D-KFC69461CAS: 1385694-61-0 | Min. 95% | - - - | Discontinued product |
Cyclohexanecarboxylic acid, 1-(2-chlorophenyl)-4-oxo-
Ref: IN-DA0018QH
| Undefined size | To inquire |
Ref: 54-OR470532
| Undefined size | To inquire |
1-(2-Chlorophenyl)-4-oxocyclohexane-1-carboxylic acid
Ref: 10-F769318
| 5g | Discontinued | Request information |
1-(2-Chlorophenyl)-4-oxocyclohexanecarboxylic acid
Ref: 3D-KFC69461
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
