CAS 1385694-64-3
:Methyl 1-(2-nitrophenyl)-4-oxocyclohexanecarboxylate
Description:
Methyl 1-(2-nitrophenyl)-4-oxocyclohexanecarboxylate is an organic compound characterized by its complex structure, which includes a cyclohexane ring, a carboxylate ester functional group, and a nitrophenyl substituent. The presence of the nitro group introduces significant polarity and can influence the compound's reactivity and solubility. This compound typically exhibits moderate to high stability under standard conditions but may undergo reactions such as nucleophilic substitution or reduction due to the presence of the nitro group. Its molecular structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. The compound's physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions between its functional groups and the solvent used. As with many organic compounds, safety precautions should be taken when handling it, as nitro compounds can be hazardous. Overall, Methyl 1-(2-nitrophenyl)-4-oxocyclohexanecarboxylate represents a versatile building block in synthetic organic chemistry.
Formula:C14H15NO5
InChI:InChI=1S/C14H15NO5/c1-20-13(17)14(8-6-10(16)7-9-14)11-4-2-3-5-12(11)15(18)19/h2-5H,6-9H2,1H3
InChI key:InChIKey=SFQGYWQFRUCNIX-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1(CCC(=O)CC1)C2=C(N(=O)=O)C=CC=C2
Synonyms:- Methyl 1-(2-nitrophenyl)-4-oxocyclohexanecarboxylate
- Cyclohexanecarboxylic acid, 1-(2-nitrophenyl)-4-oxo-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Methyl 1-(2-Nitrophenyl)-4-oxocyclohexanecarboxylate
CAS:Methyl 1-(2-Nitrophenyl)-4-oxocyclohexanecarboxylate
Molecular weight:277.27g/mol

