CAS 1385694-76-7
:Methyl 1-(2-chlorophenyl)-4-oxocyclohexanecarboxylate
Description:
Methyl 1-(2-chlorophenyl)-4-oxocyclohexanecarboxylate is an organic compound characterized by its complex structure, which includes a cyclohexane ring, a carbonyl group, and a chlorophenyl substituent. This compound typically exhibits properties associated with esters, such as being a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is likely to be soluble in organic solvents like ethanol and dichloromethane, while being less soluble in water due to its hydrophobic cyclohexane component. The presence of the chlorophenyl group may impart specific reactivity, making it of interest in various chemical reactions, including nucleophilic substitutions and cycloadditions. Additionally, the compound may exhibit biological activity, which could be relevant in pharmaceutical applications. Safety data sheets should be consulted for handling and toxicity information, as halogenated compounds can pose environmental and health risks. Overall, this compound's unique structure and properties make it a subject of interest in organic synthesis and medicinal chemistry.
Formula:C14H15ClO3
InChI:InChI=1S/C14H15ClO3/c1-18-13(17)14(8-6-10(16)7-9-14)11-4-2-3-5-12(11)15/h2-5H,6-9H2,1H3
InChI key:InChIKey=IZNSGUGIYCNZOQ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1(CCC(=O)CC1)C2=C(Cl)C=CC=C2
Synonyms:- Methyl 1-(2-chlorophenyl)-4-oxocyclohexanecarboxylate
- Cyclohexanecarboxylic acid, 1-(2-chlorophenyl)-4-oxo-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Methyl 1-(2-Chlorophenyl)-4-oxocyclohexanecarboxylate
CAS:Formula:C14H15ClO3Molecular weight:266.7201Methyl 1-(2-Chlorophenyl)-4-oxocyclohexanecarboxylate
CAS:Methyl 1-(2-Chlorophenyl)-4-oxocyclohexanecarboxylate
Molecular weight:266.72g/mol

